CAS 1803571-39-2 appears in our catalog under these names: 3,3,3-Trifluoro-2-hydroxy-N,N-dimethylpropane-1-sulfonamide, 95%, 3,3,3-Trifluoro-2-hydroxy-N,N-dimethylpropane-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3,3,3-trifluoro-2-hydroxy-N,N-dimethylpropane-1-sulfonamide (CAS 1803571-39-2) is a chemical compound with the molecular formula C5H10F3NO3S and a molecular weight of 221.20 g/mol. IUPAC name: 3,3,3-trifluoro-2-hydroxy-N,N-dimethylpropane-1-sulfonamide. InChIKey: GBZGIPXDPYQDGM-UHFFFAOYSA-N.
| Molecular formula | C5H10F3NO3S |
|---|---|
| Molecular weight | 221.20 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-hydroxy-N,N-dimethylpropane-1-sulfonamide |
| InChIKey | GBZGIPXDPYQDGM-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)CC(C(F)(F)F)O |
Computed by PubChem (NCBI)