CAS 1803582-25-3 is the registry number for 5-Nitro-2-(pentafluoroethyl)pyridin-4-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-nitro-2-(1,1,2,2,2-pentafluoroethyl)pyridin-4-amine (CAS 1803582-25-3) is a chemical compound with the molecular formula C7H4F5N3O2 and a molecular weight of 257.12 g/mol. IUPAC name: 5-nitro-2-(1,1,2,2,2-pentafluoroethyl)pyridin-4-amine. InChIKey: UMWFBMPVKSDYDK-UHFFFAOYSA-N.
| Molecular formula | C7H4F5N3O2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 5-nitro-2-(1,1,2,2,2-pentafluoroethyl)pyridin-4-amine |
| InChIKey | UMWFBMPVKSDYDK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(C(F)(F)F)(F)F)[N+](=O)[O-])N |
Computed by PubChem (NCBI)