CAS 1803582-43-5 is the registry number for Ethyl 4-(3-(pyridin-3-yl)-1,2,4-oxadiazol-5-yl)-1,3-thiazole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 4-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-thiazole-2-carboxylate (CAS 1803582-43-5) is a chemical compound with the molecular formula C13H10N4O3S and a molecular weight of 302.31 g/mol. IUPAC name: ethyl 4-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-thiazole-2-carboxylate. InChIKey: OGVOBDGICAJFDM-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O3S |
|---|---|
| Molecular weight | 302.31 g/mol |
| IUPAC name | ethyl 4-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-thiazole-2-carboxylate |
| InChIKey | OGVOBDGICAJFDM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=CS1)C2=NC(=NO2)C3=CN=CC=C3 |
Computed by PubChem (NCBI)