CAS 1803582-61-7 is the registry number for 4-methyl-5-phenyl-4H-1,2,4-triazole-3-carboxylate lithium (I). Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Lithium 4-methyl-5-phenyl-1,2,4-triazole-3-carboxylate (CAS 1803582-61-7) is a chemical compound with the molecular formula C10H8LiN3O2 and a molecular weight of 209.2 g/mol. IUPAC name: lithium 4-methyl-5-phenyl-1,2,4-triazole-3-carboxylate. InChIKey: NGTWVPJHVJWSED-UHFFFAOYSA-M.
| Molecular formula | C10H8LiN3O2 |
|---|---|
| Molecular weight | 209.2 g/mol |
| IUPAC name | lithium 4-methyl-5-phenyl-1,2,4-triazole-3-carboxylate |
| InChIKey | NGTWVPJHVJWSED-UHFFFAOYSA-M |
| SMILES | [Li+].CN1C(=NN=C1C(=O)[O-])C2=CC=CC=C2 |
Computed by PubChem (NCBI)