CAS 1803582-87-7 appears in our catalog under these names: 4-((4-Bromophenyl)methoxy)phenyl benzoate, 95%, 4-((4-Bromophenyl)methoxy)phenyl benzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
[4-[(4-bromophenyl)methoxy]phenyl] benzoate (CAS 1803582-87-7) is a chemical compound with the molecular formula C20H15BrO3 and a molecular weight of 383.2 g/mol. IUPAC name: [4-[(4-bromophenyl)methoxy]phenyl] benzoate. InChIKey: TYBDFPFKJSUJKU-UHFFFAOYSA-N.
| Molecular formula | C20H15BrO3 |
|---|---|
| Molecular weight | 383.2 g/mol |
| IUPAC name | [4-[(4-bromophenyl)methoxy]phenyl] benzoate |
| InChIKey | TYBDFPFKJSUJKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC=C(C=C2)OCC3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)