CAS 1803582-93-5 appears in our catalog under these names: tert-Butyl 2,2,2-trifluoroethyl oxalate, 95%, tert-Butyl 2,2,2-trifluoroethyl oxalate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-O-tert-butyl 1-O-(2,2,2-trifluoroethyl) oxalate (CAS 1803582-93-5) is a chemical compound with the molecular formula C8H11F3O4 and a molecular weight of 228.17 g/mol. IUPAC name: 2-O-tert-butyl 1-O-(2,2,2-trifluoroethyl) oxalate. InChIKey: VAYBILISVGIYDM-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O4 |
|---|---|
| Molecular weight | 228.17 g/mol |
| IUPAC name | 2-O-tert-butyl 1-O-(2,2,2-trifluoroethyl) oxalate |
| InChIKey | VAYBILISVGIYDM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)