CAS 1803583-13-2 appears in our catalog under these names: 1-((Dimethyl-1,2-oxazol-4-yl)sulfonyl)piperazine hydrochloride, 95%, 1-((Dimethyl-1,2-oxazol-4-yl)sulfonyl)piperazine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride (CAS 1803583-13-2) is a chemical compound with the molecular formula C9H16ClN3O3S and a molecular weight of 281.76 g/mol. IUPAC name: 3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride. InChIKey: WGFHCNAPSCMSCF-UHFFFAOYSA-N.
| Molecular formula | C9H16ClN3O3S |
|---|---|
| Molecular weight | 281.76 g/mol |
| IUPAC name | 3,5-dimethyl-4-piperazin-1-ylsulfonyl-1,2-oxazole;hydrochloride |
| InChIKey | WGFHCNAPSCMSCF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)S(=O)(=O)N2CCNCC2.Cl |
Computed by PubChem (NCBI)