CAS 1803584-00-0 is the registry number for (2-Methyl-4-(trifluoromethyl)-1,3-thiazol-5-yl)methanol hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[2-methyl-4-(trifluoromethyl)-1,3-thiazol-5-yl]methanol;hydrochloride (CAS 1803584-00-0) is a chemical compound with the molecular formula C6H7ClF3NOS and a molecular weight of 233.64 g/mol. IUPAC name: [2-methyl-4-(trifluoromethyl)-1,3-thiazol-5-yl]methanol;hydrochloride. InChIKey: VMHCVILEWMQRSO-UHFFFAOYSA-N.
| Molecular formula | C6H7ClF3NOS |
|---|---|
| Molecular weight | 233.64 g/mol |
| IUPAC name | [2-methyl-4-(trifluoromethyl)-1,3-thiazol-5-yl]methanol;hydrochloride |
| InChIKey | VMHCVILEWMQRSO-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)CO)C(F)(F)F.Cl |
Computed by PubChem (NCBI)