Products 1803584-10-2

CAS 1803584-10-2 appears in our catalog under these names: 2-Trifluoromethanesulfonylethane-1-sulfonyl chloride, 2-Trifluoromethanesulfonylethane-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.

2-(trifluoromethylsulfonyl)ethanesulfonyl chloride (CAS 1803584-10-2) is a chemical compound with the molecular formula C3H4ClF3O4S2 and a molecular weight of 260.6 g/mol. IUPAC name: 2-(trifluoromethylsulfonyl)ethanesulfonyl chloride. InChIKey: FXYGMSFYPJQLHE-UHFFFAOYSA-N.

Identity
Molecular formulaC3H4ClF3O4S2
Molecular weight260.6 g/mol
IUPAC name2-(trifluoromethylsulfonyl)ethanesulfonyl chloride
InChIKeyFXYGMSFYPJQLHE-UHFFFAOYSA-N
SMILESC(CS(=O)(=O)Cl)S(=O)(=O)C(F)(F)F

Computed by PubChem (NCBI)