Products 1803584-32-8

CAS 1803584-32-8 appears in our catalog under these names: 2,6-Bis(2-methylpropyl)piperidine hydrochloride, 95%, 2,6-Bis(2-methylpropyl)piperidine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2,6-bis(2-methylpropyl)piperidine;hydrochloride (CAS 1803584-32-8) is a chemical compound with the molecular formula C13H28ClN and a molecular weight of 233.82 g/mol. IUPAC name: 2,6-bis(2-methylpropyl)piperidine;hydrochloride. InChIKey: CRHYTGCFVCDMSU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H28ClN
Molecular weight233.82 g/mol
IUPAC name2,6-bis(2-methylpropyl)piperidine;hydrochloride
InChIKeyCRHYTGCFVCDMSU-UHFFFAOYSA-N
SMILESCC(C)CC1CCCC(N1)CC(C)C.Cl

Computed by PubChem (NCBI)