CAS 1803585-02-5 is the registry number for Sodium (diethylcarbamoyl)methanesulfonate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Sodium 2-(diethylamino)-2-oxoethanesulfonate (CAS 1803585-02-5) is a chemical compound with the molecular formula C6H12NNaO4S and a molecular weight of 217.22 g/mol. IUPAC name: sodium 2-(diethylamino)-2-oxoethanesulfonate. InChIKey: KVUHUAGUHPNFPK-UHFFFAOYSA-M.
| Molecular formula | C6H12NNaO4S |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | sodium 2-(diethylamino)-2-oxoethanesulfonate |
| InChIKey | KVUHUAGUHPNFPK-UHFFFAOYSA-M |
| SMILES | CCN(CC)C(=O)CS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)