CAS 1803585-61-6 is the registry number for 5-Benzyl-1,3-oxazole-2-carboxylate lithium. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Lithium 5-benzyl-1,3-oxazole-2-carboxylate (CAS 1803585-61-6) is a chemical compound with the molecular formula C11H8LiNO3 and a molecular weight of 209.2 g/mol. IUPAC name: lithium 5-benzyl-1,3-oxazole-2-carboxylate. InChIKey: PRQIOVFMMIKFOZ-UHFFFAOYSA-M.
| Molecular formula | C11H8LiNO3 |
|---|---|
| Molecular weight | 209.2 g/mol |
| IUPAC name | lithium 5-benzyl-1,3-oxazole-2-carboxylate |
| InChIKey | PRQIOVFMMIKFOZ-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC=C(C=C1)CC2=CN=C(O2)C(=O)[O-] |
Computed by PubChem (NCBI)