Products 1803585-77-4

CAS 1803585-77-4 is the registry number for tert-Butyl 3-(1,3-benzothiazol-2-yl)morpholine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 3-(1,3-benzothiazol-2-yl)morpholine-4-carboxylate (CAS 1803585-77-4) is a chemical compound with the molecular formula C16H20N2O3S and a molecular weight of 320.4 g/mol. IUPAC name: tert-butyl 3-(1,3-benzothiazol-2-yl)morpholine-4-carboxylate. InChIKey: PVSHZAGTMBVNHP-UHFFFAOYSA-N.

Identity
Molecular formulaC16H20N2O3S
Molecular weight320.4 g/mol
IUPAC nametert-butyl 3-(1,3-benzothiazol-2-yl)morpholine-4-carboxylate
InChIKeyPVSHZAGTMBVNHP-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCOCC1C2=NC3=CC=CC=C3S2

Computed by PubChem (NCBI)