CAS 1803587-37-2 is the registry number for (2-Bromo-5-nitrophenyl)hydrazine dihydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(2-bromo-5-nitrophenyl)hydrazine;dihydrochloride (CAS 1803587-37-2) is a chemical compound with the molecular formula C6H8BrCl2N3O2 and a molecular weight of 304.95 g/mol. IUPAC name: (2-bromo-5-nitrophenyl)hydrazine;dihydrochloride. InChIKey: JZQRLLGVIYIALQ-UHFFFAOYSA-N.
| Molecular formula | C6H8BrCl2N3O2 |
|---|---|
| Molecular weight | 304.95 g/mol |
| IUPAC name | (2-bromo-5-nitrophenyl)hydrazine;dihydrochloride |
| InChIKey | JZQRLLGVIYIALQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])NN)Br.Cl.Cl |
Computed by PubChem (NCBI)