Products 1803589-18-5
CAS 1803589-18-5 appears in our catalog under these names: 1-Methyl-3-(piperidin-3-yl)-1H-pyrazole-4-carboxamide Hydrochloride, 1-Methyl-3-(piperidin-3-yl)-1H-pyrazole-4-carboxamide hydrochloride, 95%. Offered by: TRC, AmBeed. Available pack sizes: 500mg, 1g.
1-methyl-3-piperidin-3-ylpyrazole-4-carboxamide;hydrochloride (CAS 1803589-18-5) is a chemical compound with the molecular formula C10H17ClN4O and a molecular weight of 244.72 g/mol. IUPAC name: 1-methyl-3-piperidin-3-ylpyrazole-4-carboxamide;hydrochloride. InChIKey: XDLBRRLEXNVVMP-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN4O |
|---|---|
| Molecular weight | 244.72 g/mol |
| IUPAC name | 1-methyl-3-piperidin-3-ylpyrazole-4-carboxamide;hydrochloride |
| InChIKey | XDLBRRLEXNVVMP-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C2CCCNC2)C(=O)N.Cl |
Computed by PubChem (NCBI)