CAS 1803589-65-2 appears in our catalog under these names: 2,4,6-Trichloropyridine-3-sulfonyl chloride, 95%, 2,4,6-Trichloropyridine-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,4,6-trichloropyridine-3-sulfonyl chloride (CAS 1803589-65-2) is a chemical compound with the molecular formula C5HCl4NO2S and a molecular weight of 280.9 g/mol. IUPAC name: 2,4,6-trichloropyridine-3-sulfonyl chloride. InChIKey: VOXGMYIACWJQBI-UHFFFAOYSA-N.
| Molecular formula | C5HCl4NO2S |
|---|---|
| Molecular weight | 280.9 g/mol |
| IUPAC name | 2,4,6-trichloropyridine-3-sulfonyl chloride |
| InChIKey | VOXGMYIACWJQBI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)Cl)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)