Products 1803589-65-2

CAS 1803589-65-2 appears in our catalog under these names: 2,4,6-Trichloropyridine-3-sulfonyl chloride, 95%, 2,4,6-Trichloropyridine-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,4,6-trichloropyridine-3-sulfonyl chloride (CAS 1803589-65-2) is a chemical compound with the molecular formula C5HCl4NO2S and a molecular weight of 280.9 g/mol. IUPAC name: 2,4,6-trichloropyridine-3-sulfonyl chloride. InChIKey: VOXGMYIACWJQBI-UHFFFAOYSA-N.

Identity
Molecular formulaC5HCl4NO2S
Molecular weight280.9 g/mol
IUPAC name2,4,6-trichloropyridine-3-sulfonyl chloride
InChIKeyVOXGMYIACWJQBI-UHFFFAOYSA-N
SMILESC1=C(C(=C(N=C1Cl)Cl)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)