CAS 1803590-23-9 appears in our catalog under these names: 2-(2,4-Dichlorophenoxy)-1-(piperazin-1-yl)ethan-1-one hydrochloride, 95%, 2-(2,4-Dichlorophenoxy)-1-(piperazin-1-yl)ethan-1-one hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 2,5g, 250mg.
2-(2,4-dichlorophenoxy)-1-piperazin-1-ylethanone;hydrochloride (CAS 1803590-23-9) is a chemical compound with the molecular formula C12H15Cl3N2O2 and a molecular weight of 325.6 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)-1-piperazin-1-ylethanone;hydrochloride. InChIKey: CBQSFOMAQKAZJB-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl3N2O2 |
|---|---|
| Molecular weight | 325.6 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)-1-piperazin-1-ylethanone;hydrochloride |
| InChIKey | CBQSFOMAQKAZJB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)COC2=C(C=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)