CAS 1803590-32-0 appears in our catalog under these names: 2-(2,3,6-Trifluorophenyl)propanedinitrile, 95%, 2-(2,3,6-Trifluorophenyl)propanedinitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(2,3,6-trifluorophenyl)propanedinitrile (CAS 1803590-32-0) is a chemical compound with the molecular formula C9H3F3N2 and a molecular weight of 196.13 g/mol. IUPAC name: 2-(2,3,6-trifluorophenyl)propanedinitrile. InChIKey: PBNMFLPOBUPOBF-UHFFFAOYSA-N.
| Molecular formula | C9H3F3N2 |
|---|---|
| Molecular weight | 196.13 g/mol |
| IUPAC name | 2-(2,3,6-trifluorophenyl)propanedinitrile |
| InChIKey | PBNMFLPOBUPOBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(C#N)C#N)F)F |
Computed by PubChem (NCBI)