Products 1803590-62-6
CAS 1803590-62-6 is the registry number for 2,2-Dimethyl-N-(4-(trifluoromethyl)pyridin-2-yl)propanamide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2,2-dimethyl-N-[4-(trifluoromethyl)-2-pyridinyl]propanamide (CAS 1803590-62-6) is a chemical compound with the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. IUPAC name: 2,2-dimethyl-N-[4-(trifluoromethyl)-2-pyridinyl]propanamide. InChIKey: ORTLFEIRUSAKMZ-UHFFFAOYSA-N.
| Molecular formula | C11H13F3N2O |
|---|---|
| Molecular weight | 246.23 g/mol |
| IUPAC name | 2,2-dimethyl-N-[4-(trifluoromethyl)-2-pyridinyl]propanamide |
| InChIKey | ORTLFEIRUSAKMZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=CC(=C1)C(F)(F)F |
Computed by PubChem (NCBI)