CAS 1803591-59-4 appears in our catalog under these names: 1-Amino-3-(propan-2-yl)-2,3-dihydro-1H-indene-1-carboxylic acid, 95%, 1-Amino-3-(propan-2-yl)-2,3-dihydro-1H-indene-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-amino-3-propan-2-yl-2,3-dihydroindene-1-carboxylic acid (CAS 1803591-59-4) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: 1-amino-3-propan-2-yl-2,3-dihydroindene-1-carboxylic acid. InChIKey: GKXUZTINRJOQLC-UHFFFAOYSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 1-amino-3-propan-2-yl-2,3-dihydroindene-1-carboxylic acid |
| InChIKey | GKXUZTINRJOQLC-UHFFFAOYSA-N |
| SMILES | CC(C)C1CC(C2=CC=CC=C12)(C(=O)O)N |
Computed by PubChem (NCBI)