CAS 1803591-67-4 appears in our catalog under these names: Potassium 2-carbamoyl-2,2-difluoroacetate, 95%, Potassium 2-carbamoyl-2,2-difluoroacetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Potassium 3-amino-2,2-difluoro-3-oxopropanoate (CAS 1803591-67-4) is a chemical compound with the molecular formula C3H2F2KNO3 and a molecular weight of 177.15 g/mol. IUPAC name: potassium 3-amino-2,2-difluoro-3-oxopropanoate. InChIKey: YTFGAAYVBUHQKY-UHFFFAOYSA-M.
| Molecular formula | C3H2F2KNO3 |
|---|---|
| Molecular weight | 177.15 g/mol |
| IUPAC name | potassium 3-amino-2,2-difluoro-3-oxopropanoate |
| InChIKey | YTFGAAYVBUHQKY-UHFFFAOYSA-M |
| SMILES | C(=O)(C(C(=O)[O-])(F)F)N.[K+] |
Computed by PubChem (NCBI)