CAS 1803591-74-3 is the registry number for 2-(1,1,1-Trifluoro-2-methylpropan-2-yl)propanedioic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(1,1,1-trifluoro-2-methylpropan-2-yl)propanedioic acid (CAS 1803591-74-3) is a chemical compound with the molecular formula C7H9F3O4 and a molecular weight of 214.14 g/mol. IUPAC name: 2-(1,1,1-trifluoro-2-methylpropan-2-yl)propanedioic acid. InChIKey: UJYVYYSQHNASND-UHFFFAOYSA-N.
| Molecular formula | C7H9F3O4 |
|---|---|
| Molecular weight | 214.14 g/mol |
| IUPAC name | 2-(1,1,1-trifluoro-2-methylpropan-2-yl)propanedioic acid |
| InChIKey | UJYVYYSQHNASND-UHFFFAOYSA-N |
| SMILES | CC(C)(C(C(=O)O)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)