CAS 1803592-08-6 is the registry number for 4-(5,6,7,8-Tetrahydronaphthalen-2-yl)-1,3-thiazol-2-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-amine;hydrochloride (CAS 1803592-08-6) is a chemical compound with the molecular formula C13H15ClN2S and a molecular weight of 266.79 g/mol. IUPAC name: 4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-amine;hydrochloride. InChIKey: VUXNDNISHBARNV-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2S |
|---|---|
| Molecular weight | 266.79 g/mol |
| IUPAC name | 4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | VUXNDNISHBARNV-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC(=C2)C3=CSC(=N3)N.Cl |
Computed by PubChem (NCBI)