CAS 1803594-93-5 appears in our catalog under these names: 1-(Methoxymethyl)-1H-pyrazole-5-sulfonyl chloride, 1-(Methoxymethyl)-1H-pyrazole-5-sulfonyl chloride, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-(methoxymethyl)pyrazole-3-sulfonyl chloride (CAS 1803594-93-5) is a chemical compound with the molecular formula C5H7ClN2O3S and a molecular weight of 210.64 g/mol. IUPAC name: 2-(methoxymethyl)pyrazole-3-sulfonyl chloride. InChIKey: YEDQYIREWASRGU-UHFFFAOYSA-N.
| Molecular formula | C5H7ClN2O3S |
|---|---|
| Molecular weight | 210.64 g/mol |
| IUPAC name | 2-(methoxymethyl)pyrazole-3-sulfonyl chloride |
| InChIKey | YEDQYIREWASRGU-UHFFFAOYSA-N |
| SMILES | COCN1C(=CC=N1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)