CAS 1803595-06-3 is the registry number for 5-(4-Chlorophenyl)-1,3-thiazole-2-carboxylate lithium(I). Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Lithium 5-(4-chlorophenyl)-1,3-thiazole-2-carboxylate (CAS 1803595-06-3) is a chemical compound with the molecular formula C10H5ClLiNO2S and a molecular weight of 245.6 g/mol. IUPAC name: lithium 5-(4-chlorophenyl)-1,3-thiazole-2-carboxylate. InChIKey: JQOOQVIGJYDXQI-UHFFFAOYSA-M.
| Molecular formula | C10H5ClLiNO2S |
|---|---|
| Molecular weight | 245.6 g/mol |
| IUPAC name | lithium 5-(4-chlorophenyl)-1,3-thiazole-2-carboxylate |
| InChIKey | JQOOQVIGJYDXQI-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC(=CC=C1C2=CN=C(S2)C(=O)[O-])Cl |
Computed by PubChem (NCBI)