CAS 1803595-97-2 is the registry number for 5-Bromo-8-nitro-1,2,3,4-tetrahydroisoquinoline hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromo-8-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 1803595-97-2) is a chemical compound with the molecular formula C9H10BrClN2O2 and a molecular weight of 293.54 g/mol. IUPAC name: 5-bromo-8-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: OBNWKVUZCDZPQV-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClN2O2 |
|---|---|
| Molecular weight | 293.54 g/mol |
| IUPAC name | 5-bromo-8-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | OBNWKVUZCDZPQV-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C(C=CC(=C21)Br)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)