Products 1803596-06-6

CAS 1803596-06-6 is the registry number for 2-Fluorocyclopentane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-fluorocyclopentane-1-sulfonyl chloride (CAS 1803596-06-6) is a chemical compound with the molecular formula C5H8ClFO2S and a molecular weight of 186.63 g/mol. IUPAC name: 2-fluorocyclopentane-1-sulfonyl chloride. InChIKey: XKSZTDRWWIVGEF-UHFFFAOYSA-N.

Identity
Molecular formulaC5H8ClFO2S
Molecular weight186.63 g/mol
IUPAC name2-fluorocyclopentane-1-sulfonyl chloride
InChIKeyXKSZTDRWWIVGEF-UHFFFAOYSA-N
SMILESC1CC(C(C1)S(=O)(=O)Cl)F

Computed by PubChem (NCBI)