CAS 1803596-28-2 appears in our catalog under these names: Potassium 2,2-difluoro-4-methyl-3-oxopentanoate, 95%, Potassium 2,2-difluoro-4-methyl-3-oxopentanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Potassium 2,2-difluoro-4-methyl-3-oxopentanoate (CAS 1803596-28-2) is a chemical compound with the molecular formula C6H7F2KO3 and a molecular weight of 204.21 g/mol. IUPAC name: potassium 2,2-difluoro-4-methyl-3-oxopentanoate. InChIKey: JMBBENHXWYDBKE-UHFFFAOYSA-M.
| Molecular formula | C6H7F2KO3 |
|---|---|
| Molecular weight | 204.21 g/mol |
| IUPAC name | potassium 2,2-difluoro-4-methyl-3-oxopentanoate |
| InChIKey | JMBBENHXWYDBKE-UHFFFAOYSA-M |
| SMILES | CC(C)C(=O)C(C(=O)[O-])(F)F.[K+] |
Computed by PubChem (NCBI)