CAS 1803596-74-8 is the registry number for 6-tert-butyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2-carboxylate lithium. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Lithium 6-tert-butyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2-carboxylate (CAS 1803596-74-8) is a chemical compound with the molecular formula C12H16LiNO2S and a molecular weight of 245.3 g/mol. IUPAC name: lithium 6-tert-butyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2-carboxylate. InChIKey: ZTFVEGWLPHALNI-UHFFFAOYSA-M.
| Molecular formula | C12H16LiNO2S |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | lithium 6-tert-butyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2-carboxylate |
| InChIKey | ZTFVEGWLPHALNI-UHFFFAOYSA-M |
| SMILES | [Li+].CC(C)(C)C1CCC2=C(C1)SC(=N2)C(=O)[O-] |
Computed by PubChem (NCBI)