Products 1803596-96-4
CAS 1803596-96-4 is the registry number for 1-(3-Azidopropyl)pyrrolidine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(3-azidopropyl)pyrrolidine;hydrochloride (CAS 1803596-96-4) is a chemical compound with the molecular formula C7H15ClN4 and a molecular weight of 190.67 g/mol. IUPAC name: 1-(3-azidopropyl)pyrrolidine;hydrochloride. InChIKey: QILRPESUGKSTBT-UHFFFAOYSA-N.
| Molecular formula | C7H15ClN4 |
|---|---|
| Molecular weight | 190.67 g/mol |
| IUPAC name | 1-(3-azidopropyl)pyrrolidine;hydrochloride |
| InChIKey | QILRPESUGKSTBT-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CCCN=[N+]=[N-].Cl |
Computed by PubChem (NCBI)