CAS 1803596-98-6 is the registry number for 1-Benzyl-2-phenyl-1H,2H,3H-imidazo(4,5-c)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-benzyl-2-phenyl-2,3-dihydroimidazo[4,5-c]pyridine (CAS 1803596-98-6) is a chemical compound with the molecular formula C19H17N3 and a molecular weight of 287.4 g/mol. IUPAC name: 1-benzyl-2-phenyl-2,3-dihydroimidazo[4,5-c]pyridine. InChIKey: LVDUUYLZAGTHRA-UHFFFAOYSA-N.
| Molecular formula | C19H17N3 |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | 1-benzyl-2-phenyl-2,3-dihydroimidazo[4,5-c]pyridine |
| InChIKey | LVDUUYLZAGTHRA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(NC3=C2C=CN=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)