CAS 1803597-00-3 appears in our catalog under these names: 4-tert-Butyl-2-(2,6-difluorophenyl)-1,3-thiazole hydrochloride, 95%, 4-tert-Butyl-2-(2,6-difluorophenyl)-1,3-thiazole hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-tert-butyl-2-(2,6-difluorophenyl)-1,3-thiazole;hydrochloride (CAS 1803597-00-3) is a chemical compound with the molecular formula C13H14ClF2NS and a molecular weight of 289.77 g/mol. IUPAC name: 4-tert-butyl-2-(2,6-difluorophenyl)-1,3-thiazole;hydrochloride. InChIKey: CEUBCVHEVQFNNP-UHFFFAOYSA-N.
| Molecular formula | C13H14ClF2NS |
|---|---|
| Molecular weight | 289.77 g/mol |
| IUPAC name | 4-tert-butyl-2-(2,6-difluorophenyl)-1,3-thiazole;hydrochloride |
| InChIKey | CEUBCVHEVQFNNP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CSC(=N1)C2=C(C=CC=C2F)F.Cl |
Computed by PubChem (NCBI)