CAS 1803598-39-1 is the registry number for Potassium 5,7-difluoro-3-methyl-1-benzofuran-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Potassium 5,7-difluoro-3-methyl-1-benzofuran-2-carboxylate (CAS 1803598-39-1) is a chemical compound with the molecular formula C10H5F2KO3 and a molecular weight of 250.24 g/mol. IUPAC name: potassium 5,7-difluoro-3-methyl-1-benzofuran-2-carboxylate. InChIKey: JVELCOJHBHVJCG-UHFFFAOYSA-M.
| Molecular formula | C10H5F2KO3 |
|---|---|
| Molecular weight | 250.24 g/mol |
| IUPAC name | potassium 5,7-difluoro-3-methyl-1-benzofuran-2-carboxylate |
| InChIKey | JVELCOJHBHVJCG-UHFFFAOYSA-M |
| SMILES | CC1=C(OC2=C1C=C(C=C2F)F)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)