CAS 1803598-50-6 appears in our catalog under these names: (3,5-Dibromo-4-methylphenyl)(2-ethyl-1-benzofuran-3-yl)methanol, 95%, (3,5-Dibromo-4-methylphenyl)(2-ethyl-1-benzofuran-3-yl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(3,5-dibromo-4-methylphenyl)-(2-ethyl-1-benzofuran-3-yl)methanol (CAS 1803598-50-6) is a chemical compound with the molecular formula C18H16Br2O2 and a molecular weight of 424.1 g/mol. IUPAC name: (3,5-dibromo-4-methylphenyl)-(2-ethyl-1-benzofuran-3-yl)methanol. InChIKey: HDVKSPUZURDZDG-UHFFFAOYSA-N.
| Molecular formula | C18H16Br2O2 |
|---|---|
| Molecular weight | 424.1 g/mol |
| IUPAC name | (3,5-dibromo-4-methylphenyl)-(2-ethyl-1-benzofuran-3-yl)methanol |
| InChIKey | HDVKSPUZURDZDG-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=CC=CC=C2O1)C(C3=CC(=C(C(=C3)Br)C)Br)O |
Computed by PubChem (NCBI)