CAS 1803599-13-4 appears in our catalog under these names: 5-Methyl-1-(pyridin-4-ylmethyl)-1H-1,2,3-triazol-4-amine dihydrochloride, 95%, 5-Methyl-1-((pyridin-4-yl)methyl)-1H-1,2,3-triazol-4-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-methyl-1-(pyridin-4-ylmethyl)triazol-4-amine;dihydrochloride (CAS 1803599-13-4) is a chemical compound with the molecular formula C9H13Cl2N5 and a molecular weight of 262.14 g/mol. IUPAC name: 5-methyl-1-(pyridin-4-ylmethyl)triazol-4-amine;dihydrochloride. InChIKey: OXPJYGXRSKSEPL-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2N5 |
|---|---|
| Molecular weight | 262.14 g/mol |
| IUPAC name | 5-methyl-1-(pyridin-4-ylmethyl)triazol-4-amine;dihydrochloride |
| InChIKey | OXPJYGXRSKSEPL-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1CC2=CC=NC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)