CAS 1803599-22-5 appears in our catalog under these names: tert-Butyl 3-{((tert-butoxy)carbonyl)amino}-5-chloro-4-oxopentanoate, 95%, tert-Butyl 3-{((tert-butoxy)carbonyl)amino}-5-chloro-4-oxopentanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl 5-chloro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate (CAS 1803599-22-5) is a chemical compound with the molecular formula C14H24ClNO5 and a molecular weight of 321.80 g/mol. IUPAC name: tert-butyl 5-chloro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate. InChIKey: VTHBKGXYYOJNTJ-UHFFFAOYSA-N.
| Molecular formula | C14H24ClNO5 |
|---|---|
| Molecular weight | 321.80 g/mol |
| IUPAC name | tert-butyl 5-chloro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate |
| InChIKey | VTHBKGXYYOJNTJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC(C(=O)CCl)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)