CAS 1803599-40-7 appears in our catalog under these names: Potassium 2-(1,2-oxazol-3-yloxy)acetate, 95%, Potassium 2-(1,2-oxazol-3-yloxy)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Potassium 2-(1,2-oxazol-3-yloxy)acetate (CAS 1803599-40-7) is a chemical compound with the molecular formula C5H4KNO4 and a molecular weight of 181.19 g/mol. IUPAC name: potassium 2-(1,2-oxazol-3-yloxy)acetate. InChIKey: NUFSZBJCKJWCKA-UHFFFAOYSA-M.
| Molecular formula | C5H4KNO4 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | potassium 2-(1,2-oxazol-3-yloxy)acetate |
| InChIKey | NUFSZBJCKJWCKA-UHFFFAOYSA-M |
| SMILES | C1=CON=C1OCC(=O)[O-].[K+] |
Computed by PubChem (NCBI)