CAS 1803599-70-3 is the registry number for 5-Chloro-3-methyl-4-nitro-1,2-oxazole, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-chloro-3-methyl-4-nitro-1,2-oxazole (CAS 1803599-70-3) is a chemical compound with the molecular formula C4H3ClN2O3 and a molecular weight of 162.53 g/mol. IUPAC name: 5-chloro-3-methyl-4-nitro-1,2-oxazole. InChIKey: GHCCXOAHHAWPQR-UHFFFAOYSA-N.
| Molecular formula | C4H3ClN2O3 |
|---|---|
| Molecular weight | 162.53 g/mol |
| IUPAC name | 5-chloro-3-methyl-4-nitro-1,2-oxazole |
| InChIKey | GHCCXOAHHAWPQR-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)