Products 1803600-92-1
CAS 1803600-92-1 is the registry number for 1-(4-Fluorophenyl)-4,6-dioxo-1,4,5,6-tetrahydropyridazine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carboxylic acid (CAS 1803600-92-1) is a chemical compound with the molecular formula C11H7FN2O4 and a molecular weight of 250.18 g/mol. IUPAC name: 1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carboxylic acid. InChIKey: HTYMKHSFIQOQQY-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2O4 |
|---|---|
| Molecular weight | 250.18 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-4,6-dioxopyridazine-3-carboxylic acid |
| InChIKey | HTYMKHSFIQOQQY-UHFFFAOYSA-N |
| SMILES | C1C(=O)C(=NN(C1=O)C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)