Products 1803602-11-0
CAS 1803602-11-0 is the registry number for tert-Butyl 8-benzyl-6,6-dimethyl-5-oxa-2,8-diazaspiro(3.5)nonane-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 8-benzyl-6,6-dimethyl-5-oxa-2,8-diazaspiro[3.5]nonane-2-carboxylate (CAS 1803602-11-0) is a chemical compound with the molecular formula C20H30N2O3 and a molecular weight of 346.5 g/mol. IUPAC name: tert-butyl 8-benzyl-6,6-dimethyl-5-oxa-2,8-diazaspiro[3.5]nonane-2-carboxylate. InChIKey: KSQOYFIKMBNZON-UHFFFAOYSA-N.
| Molecular formula | C20H30N2O3 |
|---|---|
| Molecular weight | 346.5 g/mol |
| IUPAC name | tert-butyl 8-benzyl-6,6-dimethyl-5-oxa-2,8-diazaspiro[3.5]nonane-2-carboxylate |
| InChIKey | KSQOYFIKMBNZON-UHFFFAOYSA-N |
| SMILES | CC1(CN(CC2(O1)CN(C2)C(=O)OC(C)(C)C)CC3=CC=CC=C3)C |
Computed by PubChem (NCBI)