CAS 1803604-42-3 appears in our catalog under these names: tert-Butyl N-{2-(5-(4-chlorophenyl)-4H-1,2,4-triazol-3-yl)ethyl}carbamate, 95%, tert-Butyl N-{2-(5-(4-chlorophenyl)-4H-1,2,4-triazol-3-yl)ethyl}carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl N-[2-[3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]ethyl]carbamate (CAS 1803604-42-3) is a chemical compound with the molecular formula C15H19ClN4O2 and a molecular weight of 322.79 g/mol. IUPAC name: tert-butyl N-[2-[3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]ethyl]carbamate. InChIKey: NZRDNRPNRUFYKJ-UHFFFAOYSA-N.
| Molecular formula | C15H19ClN4O2 |
|---|---|
| Molecular weight | 322.79 g/mol |
| IUPAC name | tert-butyl N-[2-[3-(4-chlorophenyl)-1H-1,2,4-triazol-5-yl]ethyl]carbamate |
| InChIKey | NZRDNRPNRUFYKJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC1=NC(=NN1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)