CAS 1803604-49-0 appears in our catalog under these names: Methyl 3-((5-nitro-1,3-thiazol-2-yl)sulfonyl)propanoate, 95%, Methyl 3-((5-nitro-1,3-thiazol-2-yl)sulfonyl)propanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfonyl]propanoate (CAS 1803604-49-0) is a chemical compound with the molecular formula C7H8N2O6S2 and a molecular weight of 280.3 g/mol. IUPAC name: methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfonyl]propanoate. InChIKey: XZHQKUNRSQPFEY-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O6S2 |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | methyl 3-[(5-nitro-1,3-thiazol-2-yl)sulfonyl]propanoate |
| InChIKey | XZHQKUNRSQPFEY-UHFFFAOYSA-N |
| SMILES | COC(=O)CCS(=O)(=O)C1=NC=C(S1)[N+](=O)[O-] |
Computed by PubChem (NCBI)