CAS 1803604-65-0 appears in our catalog under these names: 5-Bromo-1,2-dimethyl-1H-imidazole-4-sulfonyl chloride, 95%, 5-Bromo-1,2-dimethyl-1H-imidazole-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-bromo-1,2-dimethylimidazole-4-sulfonyl chloride (CAS 1803604-65-0) is a chemical compound with the molecular formula C5H6BrClN2O2S and a molecular weight of 273.54 g/mol. IUPAC name: 5-bromo-1,2-dimethylimidazole-4-sulfonyl chloride. InChIKey: CCMFBYALMUNLNS-UHFFFAOYSA-N.
| Molecular formula | C5H6BrClN2O2S |
|---|---|
| Molecular weight | 273.54 g/mol |
| IUPAC name | 5-bromo-1,2-dimethylimidazole-4-sulfonyl chloride |
| InChIKey | CCMFBYALMUNLNS-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(N1C)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)