CAS 1803604-80-9 appears in our catalog under these names: Ethyl 2-(cyclopropanesulfonyl)-2-methylpropanoate, 95%, Ethyl 2-(cyclopropanesulfonyl)-2-methylpropanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Ethyl 2-cyclopropylsulfonyl-2-methylpropanoate (CAS 1803604-80-9) is a chemical compound with the molecular formula C9H16O4S and a molecular weight of 220.29 g/mol. IUPAC name: ethyl 2-cyclopropylsulfonyl-2-methylpropanoate. InChIKey: ZPJMHLBFHVXPPE-UHFFFAOYSA-N.
| Molecular formula | C9H16O4S |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | ethyl 2-cyclopropylsulfonyl-2-methylpropanoate |
| InChIKey | ZPJMHLBFHVXPPE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)S(=O)(=O)C1CC1 |
Computed by PubChem (NCBI)