CAS 1803606-31-6 appears in our catalog under these names: Propan-2-yl 4-((tert-butyldimethylsilyl)oxy)-2,2-dimethylbutanoate, 95%, Propan-2-yl 4-((tert-butyldimethylsilyl)oxy)-2,2-dimethylbutanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Propan-2-yl 4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylbutanoate (CAS 1803606-31-6) is a chemical compound with the molecular formula C15H32O3Si and a molecular weight of 288.50 g/mol. IUPAC name: propan-2-yl 4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylbutanoate. InChIKey: YMBBKEHYJQIRPN-UHFFFAOYSA-N.
| Molecular formula | C15H32O3Si |
|---|---|
| Molecular weight | 288.50 g/mol |
| IUPAC name | propan-2-yl 4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylbutanoate |
| InChIKey | YMBBKEHYJQIRPN-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C(C)(C)CCO[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)