Products 1803606-37-2
CAS 1803606-37-2 is the registry number for 5-(Piperidin-2-yl)-2,3-dihydro-1H-1,2,4-triazol-3-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-piperidin-2-yl-1,4-dihydro-1,2,4-triazol-5-one;hydrochloride (CAS 1803606-37-2) is a chemical compound with the molecular formula C7H13ClN4O and a molecular weight of 204.66 g/mol. IUPAC name: 3-piperidin-2-yl-1,4-dihydro-1,2,4-triazol-5-one;hydrochloride. InChIKey: QIZZEEJMZYBJGZ-UHFFFAOYSA-N.
| Molecular formula | C7H13ClN4O |
|---|---|
| Molecular weight | 204.66 g/mol |
| IUPAC name | 3-piperidin-2-yl-1,4-dihydro-1,2,4-triazol-5-one;hydrochloride |
| InChIKey | QIZZEEJMZYBJGZ-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=NNC(=O)N2.Cl |
Computed by PubChem (NCBI)