CAS 1803606-46-3 appears in our catalog under these names: 2,2-Difluoro-2-(4,5,6,7-tetrahydro-2H-indazol-3-yl)ethan-1-amine, 95%, 2,2-Difluoro-2-(4,5,6,7-tetrahydro-2H-indazol-3-yl)ethan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,2-difluoro-2-(4,5,6,7-tetrahydro-1H-indazol-3-yl)ethanamine (CAS 1803606-46-3) is a chemical compound with the molecular formula C9H13F2N3 and a molecular weight of 201.22 g/mol. IUPAC name: 2,2-difluoro-2-(4,5,6,7-tetrahydro-1H-indazol-3-yl)ethanamine. InChIKey: FTGXJLZMECITOC-UHFFFAOYSA-N.
| Molecular formula | C9H13F2N3 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 2,2-difluoro-2-(4,5,6,7-tetrahydro-1H-indazol-3-yl)ethanamine |
| InChIKey | FTGXJLZMECITOC-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NN2)C(CN)(F)F |
Computed by PubChem (NCBI)