CAS 1803606-52-1 appears in our catalog under these names: 3-(4-Aminobutyl)-1,3-diazaspiro(4.4)nonane-2,4-dione hydrochloride, 95%, 3-(4-Aminobutyl)-1,3-diazaspiro(4.4)nonane-2,4-dione hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-(4-aminobutyl)-1,3-diazaspiro[4.4]nonane-2,4-dione;hydrochloride (CAS 1803606-52-1) is a chemical compound with the molecular formula C11H20ClN3O2 and a molecular weight of 261.75 g/mol. IUPAC name: 3-(4-aminobutyl)-1,3-diazaspiro[4.4]nonane-2,4-dione;hydrochloride. InChIKey: PXOUSUCESQIECI-UHFFFAOYSA-N.
| Molecular formula | C11H20ClN3O2 |
|---|---|
| Molecular weight | 261.75 g/mol |
| IUPAC name | 3-(4-aminobutyl)-1,3-diazaspiro[4.4]nonane-2,4-dione;hydrochloride |
| InChIKey | PXOUSUCESQIECI-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)C(=O)N(C(=O)N2)CCCCN.Cl |
Computed by PubChem (NCBI)