CAS 1803608-01-6 is the registry number for Potassium 2-chloro-4-fluorobenzoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Potassium 2-chloro-4-fluorobenzoate (CAS 1803608-01-6) is a chemical compound with the molecular formula C7H3ClFKO2 and a molecular weight of 212.65 g/mol. IUPAC name: potassium 2-chloro-4-fluorobenzoate. InChIKey: DMUGFBLRCCKJIZ-UHFFFAOYSA-M.
| Molecular formula | C7H3ClFKO2 |
|---|---|
| Molecular weight | 212.65 g/mol |
| IUPAC name | potassium 2-chloro-4-fluorobenzoate |
| InChIKey | DMUGFBLRCCKJIZ-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1F)Cl)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)