CAS 1803608-69-6 is the registry number for sodium 2,3-dihydro-1h-indene-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Sodium 2,3-dihydro-1H-indene-2-carboxylate (CAS 1803608-69-6) is a chemical compound with the molecular formula C10H9NaO2 and a molecular weight of 184.17 g/mol. IUPAC name: sodium 2,3-dihydro-1H-indene-2-carboxylate. InChIKey: YQKHWYIMIDOXHK-UHFFFAOYSA-M.
| Molecular formula | C10H9NaO2 |
|---|---|
| Molecular weight | 184.17 g/mol |
| IUPAC name | sodium 2,3-dihydro-1H-indene-2-carboxylate |
| InChIKey | YQKHWYIMIDOXHK-UHFFFAOYSA-M |
| SMILES | C1C(CC2=CC=CC=C21)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)